C27H23N9O2 — CID 162683401
tert-butyl 5-[2-[2-[2-(pyrimidin-2-ylmethylamino)pyrimidin-4-yl]pyrimidin-4-yl]ethynyl]indazole-1-carboxylate (PubChem CID 162683401) has the molecular formula C27H23N9O2 and a molecular weight of 505.54 g/mol. Its IUPAC name is tert-butyl 5-[2-[2-[2-(pyrimidin-2-ylmethylamino)pyrimidin-4-yl]pyrimidin-4-yl]ethynyl]indazole-1-carboxylate.
| Compound Name | tert-butyl 5-[2-[2-[2-(pyrimidin-2-ylmethylamino)pyrimidin-4-yl]pyrimidin-4-yl]ethynyl]indazole-1-carboxylate |
|---|---|
| PubChem CID | 162683401 |
| Molecular Formula | C27H23N9O2 |
| Molecular Weight | 505.54 g/mol |
| Exact Mass | 505.20 |
| IUPAC Name | tert-butyl 5-[2-[2-[2-(pyrimidin-2-ylmethylamino)pyrimidin-4-yl]pyrimidin-4-yl]ethynyl]indazole-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)n1ncc2cc(C#Cc3ccnc(-c4ccnc(NCc5ncccn5)n4)n3)ccc21 |
| InChI | InChI=1S/C27H23N9O2/c1-27(2,3)38-26(37)36-22-8-6-18(15-19(22)16-33-36)5-7-20-9-13-30-24(34-20)21-10-14-31-25(35-21)32-17-23-28-11-4-12-29-23/h4,6,8-16H,17H2,1-3H3,(H,31,32,35) |
| InChIKey | OFOCEPRKWUKVNC-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 133.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.54 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|