C16H17N5O2 — CID 172532327
tert-butyl 5-(2-aminopyrimidin-4-yl)indazole-1-carboxylate (PubChem CID 172532327) has the molecular formula C16H17N5O2 and a molecular weight of 311.35 g/mol. Its IUPAC name is tert-butyl 5-(2-aminopyrimidin-4-yl)indazole-1-carboxylate.
| Compound Name | tert-butyl 5-(2-aminopyrimidin-4-yl)indazole-1-carboxylate |
|---|---|
| PubChem CID | 172532327 |
| Molecular Formula | C16H17N5O2 |
| Molecular Weight | 311.35 g/mol |
| Exact Mass | 311.14 |
| IUPAC Name | tert-butyl 5-(2-aminopyrimidin-4-yl)indazole-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)n1ncc2cc(-c3ccnc(N)n3)ccc21 |
| InChI | InChI=1S/C16H17N5O2/c1-16(2,3)23-15(22)21-13-5-4-10(8-11(13)9-19-21)12-6-7-18-14(17)20-12/h4-9H,1-3H3,(H2,17,18,20) |
| InChIKey | BZJPLQGMGCAEOK-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 95.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.35 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |