C29H28N8O2S2 — CID 162683375
CID 162683375 (PubChem CID 162683375) has the molecular formula C29H28N8O2S2 and a molecular weight of 584.73 g/mol.
| Compound Name | CID 162683375 |
|---|---|
| PubChem CID | 162683375 |
| Molecular Formula | C29H28N8O2S2 |
| Molecular Weight | 584.73 g/mol |
| Exact Mass | 584.18 |
| IUPAC Name | — |
| SMILES | Cc1ccc(CNc2nccc(-c3nccc(C#Cc4ccc5c(cnn5C(=O)OC(C)(C)C)c4)n3)n2)nc1.SS |
| InChI | InChI=1S/C29H26N8O2.H2S2/c1-19-5-8-23(32-16-19)18-33-27-31-14-12-24(36-27)26-30-13-11-22(35-26)9-6-20-7-10-25-21(15-20)17-34-37(25)28(38)39-29(2,3)4;1-2/h5,7-8,10-17H,18H2,1-4H3,(H,31,33,36);1-2H |
| InChIKey | CEWUKWQMTIZLBF-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 120.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.73 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|