C26H23N9O2 — CID 162683264
tert-butyl 5-[2-[2-[2-(1H-imidazol-2-ylmethylamino)pyrimidin-4-yl]pyrimidin-4-yl]ethynyl]indazole-1-carboxylate (PubChem CID 162683264) has the molecular formula C26H23N9O2 and a molecular weight of 493.53 g/mol. Its IUPAC name is tert-butyl 5-[2-[2-[2-(1H-imidazol-2-ylmethylamino)pyrimidin-4-yl]pyrimidin-4-yl]ethynyl]indazole-1-carboxylate.
| Compound Name | tert-butyl 5-[2-[2-[2-(1H-imidazol-2-ylmethylamino)pyrimidin-4-yl]pyrimidin-4-yl]ethynyl]indazole-1-carboxylate |
|---|---|
| PubChem CID | 162683264 |
| Molecular Formula | C26H23N9O2 |
| Molecular Weight | 493.53 g/mol |
| Exact Mass | 493.20 |
| IUPAC Name | tert-butyl 5-[2-[2-[2-(1H-imidazol-2-ylmethylamino)pyrimidin-4-yl]pyrimidin-4-yl]ethynyl]indazole-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)n1ncc2cc(C#Cc3ccnc(-c4ccnc(NCc5ncc[nH]5)n4)n3)ccc21 |
| InChI | InChI=1S/C26H23N9O2/c1-26(2,3)37-25(36)35-21-7-5-17(14-18(21)15-32-35)4-6-19-8-10-29-23(33-19)20-9-11-30-24(34-20)31-16-22-27-12-13-28-22/h5,7-15H,16H2,1-3H3,(H,27,28)(H,30,31,34) |
| InChIKey | HAXFPQLPHBUPQS-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 136.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.53 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|