C27H27N7O3 — CID 169059764
tert-butyl 5-[2-[2-[2-[[(1R,3R)-3-hydroxycyclopentyl]amino]pyrimidin-4-yl]pyrimidin-4-yl]ethynyl]indazole-1-carboxylate (PubChem CID 169059764) has the molecular formula C27H27N7O3 and a molecular weight of 497.56 g/mol. Its IUPAC name is tert-butyl 5-[2-[2-[2-[[(1R,3R)-3-hydroxycyclopentyl]amino]pyrimidin-4-yl]pyrimidin-4-yl]ethynyl]indazole-1-carboxylate.
| Compound Name | tert-butyl 5-[2-[2-[2-[[(1R,3R)-3-hydroxycyclopentyl]amino]pyrimidin-4-yl]pyrimidin-4-yl]ethynyl]indazole-1-carboxylate |
|---|---|
| PubChem CID | 169059764 |
| Molecular Formula | C27H27N7O3 |
| Molecular Weight | 497.56 g/mol |
| Exact Mass | 497.22 |
| IUPAC Name | tert-butyl 5-[2-[2-[2-[[(1R,3R)-3-hydroxycyclopentyl]amino]pyrimidin-4-yl]pyrimidin-4-yl]ethynyl]indazole-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)n1ncc2cc(C#Cc3ccnc(-c4ccnc(N[C@@H]5CC[C@@H](O)C5)n4)n3)ccc21 |
| InChI | InChI=1S/C27H27N7O3/c1-27(2,3)37-26(36)34-23-9-5-17(14-18(23)16-30-34)4-6-19-10-12-28-24(31-19)22-11-13-29-25(33-22)32-20-7-8-21(35)15-20/h5,9-14,16,20-21,35H,7-8,15H2,1-3H3,(H,29,32,33)/t20-,21-/m1/s1 |
| InChIKey | OVLLSOVQWKOGCO-NHCUHLMSSA-N |
| XLogP | 3.79 |
| TPSA | 127.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.56 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|