C17H24N4O2 — CID 97056352
tert-butyl 5-[[(3S)-piperidin-3-yl]amino]indazole-1-carboxylate (PubChem CID 97056352) has the molecular formula C17H24N4O2 and a molecular weight of 316.41 g/mol. Its IUPAC name is tert-butyl 5-[[(3S)-piperidin-3-yl]amino]indazole-1-carboxylate.
| Compound Name | tert-butyl 5-[[(3S)-piperidin-3-yl]amino]indazole-1-carboxylate |
|---|---|
| PubChem CID | 97056352 |
| Molecular Formula | C17H24N4O2 |
| Molecular Weight | 316.41 g/mol |
| Exact Mass | 316.19 |
| IUPAC Name | tert-butyl 5-[[(3S)-piperidin-3-yl]amino]indazole-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)n1ncc2cc(N[C@H]3CCCNC3)ccc21 |
| InChI | InChI=1S/C17H24N4O2/c1-17(2,3)23-16(22)21-15-7-6-13(9-12(15)10-19-21)20-14-5-4-8-18-11-14/h6-7,9-10,14,18,20H,4-5,8,11H2,1-3H3/t14-/m0/s1 |
| InChIKey | WLVYDODNFWRRNY-AWEZNQCLSA-N |
| XLogP | 2.98 |
| TPSA | 68.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.41 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |