C20H24N6O3 — CID 175369381
tert-butyl 5-[[6-(cyclopropylamino)pyrimidin-4-yl]amino]-6-methoxyindazole-1-carboxylate (PubChem CID 175369381) has the molecular formula C20H24N6O3 and a molecular weight of 396.45 g/mol. Its IUPAC name is tert-butyl 5-[[6-(cyclopropylamino)pyrimidin-4-yl]amino]-6-methoxyindazole-1-carboxylate.
| Compound Name | tert-butyl 5-[[6-(cyclopropylamino)pyrimidin-4-yl]amino]-6-methoxyindazole-1-carboxylate |
|---|---|
| PubChem CID | 175369381 |
| Molecular Formula | C20H24N6O3 |
| Molecular Weight | 396.45 g/mol |
| Exact Mass | 396.19 |
| IUPAC Name | tert-butyl 5-[[6-(cyclopropylamino)pyrimidin-4-yl]amino]-6-methoxyindazole-1-carboxylate |
| SMILES | COc1cc2c(cnn2C(=O)OC(C)(C)C)cc1Nc1cc(NC2CC2)ncn1 |
| InChI | InChI=1S/C20H24N6O3/c1-20(2,3)29-19(27)26-15-8-16(28-4)14(7-12(15)10-23-26)25-18-9-17(21-11-22-18)24-13-5-6-13/h7-11,13H,5-6H2,1-4H3,(H2,21,22,24,25) |
| InChIKey | VYLAMNGPQIBHAX-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 103.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.45 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |