C20H26BrN5O2 — CID 70209006
tert-butyl 4-[[6-(3-bromoanilino)pyrimidin-4-yl]amino]piperidine-1-carboxylate (PubChem CID 70209006) has the molecular formula C20H26BrN5O2 and a molecular weight of 448.37 g/mol. Its IUPAC name is tert-butyl 4-[[6-(3-bromoanilino)pyrimidin-4-yl]amino]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[[6-(3-bromoanilino)pyrimidin-4-yl]amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 70209006 |
| Molecular Formula | C20H26BrN5O2 |
| Molecular Weight | 448.37 g/mol |
| Exact Mass | 447.13 |
| IUPAC Name | tert-butyl 4-[[6-(3-bromoanilino)pyrimidin-4-yl]amino]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(Nc2cc(Nc3cccc(Br)c3)ncn2)CC1 |
| InChI | InChI=1S/C20H26BrN5O2/c1-20(2,3)28-19(27)26-9-7-15(8-10-26)24-17-12-18(23-13-22-17)25-16-6-4-5-14(21)11-16/h4-6,11-13,15H,7-10H2,1-3H3,(H2,22,23,24,25) |
| InChIKey | XFVYSJVBTGQLRF-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.37 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |