C22H29N5O3 — CID 117077336
tert-butyl 4-[[4-(2-carbamoylanilino)-2-pyridinyl]amino]piperidine-1-carboxylate (PubChem CID 117077336) has the molecular formula C22H29N5O3 and a molecular weight of 411.51 g/mol. Its IUPAC name is tert-butyl 4-[[4-(2-carbamoylanilino)-2-pyridinyl]amino]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[[4-(2-carbamoylanilino)-2-pyridinyl]amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 117077336 |
| Molecular Formula | C22H29N5O3 |
| Molecular Weight | 411.51 g/mol |
| Exact Mass | 411.23 |
| IUPAC Name | tert-butyl 4-[[4-(2-carbamoylanilino)-2-pyridinyl]amino]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(Nc2cc(Nc3ccccc3C(N)=O)ccn2)CC1 |
| InChI | InChI=1S/C22H29N5O3/c1-22(2,3)30-21(29)27-12-9-15(10-13-27)26-19-14-16(8-11-24-19)25-18-7-5-4-6-17(18)20(23)28/h4-8,11,14-15H,9-10,12-13H2,1-3H3,(H2,23,28)(H2,24,25,26) |
| InChIKey | SFDHRKPLHPBIPZ-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 109.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.51 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |