C22H30N4O3 — CID 90413447
tert-butyl 4-[2-(4-carbamoyl-5-methyl-1H-pyrrol-2-yl)anilino]piperidine-1-carboxylate (PubChem CID 90413447) has the molecular formula C22H30N4O3 and a molecular weight of 398.51 g/mol. Its IUPAC name is tert-butyl 4-[2-(4-carbamoyl-5-methyl-1H-pyrrol-2-yl)anilino]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[2-(4-carbamoyl-5-methyl-1H-pyrrol-2-yl)anilino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 90413447 |
| Molecular Formula | C22H30N4O3 |
| Molecular Weight | 398.51 g/mol |
| Exact Mass | 398.23 |
| IUPAC Name | tert-butyl 4-[2-(4-carbamoyl-5-methyl-1H-pyrrol-2-yl)anilino]piperidine-1-carboxylate |
| SMILES | Cc1[nH]c(-c2ccccc2NC2CCN(C(=O)OC(C)(C)C)CC2)cc1C(N)=O |
| InChI | InChI=1S/C22H30N4O3/c1-14-17(20(23)27)13-19(24-14)16-7-5-6-8-18(16)25-15-9-11-26(12-10-15)21(28)29-22(2,3)4/h5-8,13,15,24-25H,9-12H2,1-4H3,(H2,23,27) |
| InChIKey | MIYGMCOLKPDPEI-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 100.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.51 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |