C15H18BrN5 — CID 70209213
6-N-(3-bromophenyl)-4-N-piperidin-4-ylpyrimidine-4,6-diamine (PubChem CID 70209213) has the molecular formula C15H18BrN5 and a molecular weight of 348.25 g/mol. Its IUPAC name is 6-N-(3-bromophenyl)-4-N-piperidin-4-ylpyrimidine-4,6-diamine.
| Compound Name | 6-N-(3-bromophenyl)-4-N-piperidin-4-ylpyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 70209213 |
| Molecular Formula | C15H18BrN5 |
| Molecular Weight | 348.25 g/mol |
| Exact Mass | 347.07 |
| IUPAC Name | 6-N-(3-bromophenyl)-4-N-piperidin-4-ylpyrimidine-4,6-diamine |
| SMILES | Brc1cccc(Nc2cc(NC3CCNCC3)ncn2)c1 |
| InChI | InChI=1S/C15H18BrN5/c16-11-2-1-3-13(8-11)21-15-9-14(18-10-19-15)20-12-4-6-17-7-5-12/h1-3,8-10,12,17H,4-7H2,(H2,18,19,20,21) |
| InChIKey | UOJRMCCGZBGPDY-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 61.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.25 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |