C19H18BrN5 — CID 151427006
4-N-(3-bromophenyl)-6-N-[3-(prop-2-enylamino)phenyl]pyrimidine-4,6-diamine (PubChem CID 151427006) has the molecular formula C19H18BrN5 and a molecular weight of 396.29 g/mol. Its IUPAC name is 4-N-(3-bromophenyl)-6-N-[3-(prop-2-enylamino)phenyl]pyrimidine-4,6-diamine.
| Compound Name | 4-N-(3-bromophenyl)-6-N-[3-(prop-2-enylamino)phenyl]pyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 151427006 |
| Molecular Formula | C19H18BrN5 |
| Molecular Weight | 396.29 g/mol |
| Exact Mass | 395.07 |
| IUPAC Name | 4-N-(3-bromophenyl)-6-N-[3-(prop-2-enylamino)phenyl]pyrimidine-4,6-diamine |
| SMILES | C=CCNc1cccc(Nc2cc(Nc3cccc(Br)c3)ncn2)c1 |
| InChI | InChI=1S/C19H18BrN5/c1-2-9-21-15-6-4-8-17(11-15)25-19-12-18(22-13-23-19)24-16-7-3-5-14(20)10-16/h2-8,10-13,21H,1,9H2,(H2,22,23,24,25) |
| InChIKey | PBSNVDYCHZEAEB-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 61.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.29 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|