C19H24N2 — CID 167385074
3-N-(4-tert-butylphenyl)-1-N-prop-2-enylbenzene-1,3-diamine (PubChem CID 167385074) has the molecular formula C19H24N2 and a molecular weight of 280.42 g/mol. Its IUPAC name is 3-N-(4-tert-butylphenyl)-1-N-prop-2-enylbenzene-1,3-diamine.
| Compound Name | 3-N-(4-tert-butylphenyl)-1-N-prop-2-enylbenzene-1,3-diamine |
|---|---|
| PubChem CID | 167385074 |
| Molecular Formula | C19H24N2 |
| Molecular Weight | 280.42 g/mol |
| Exact Mass | 280.19 |
| IUPAC Name | 3-N-(4-tert-butylphenyl)-1-N-prop-2-enylbenzene-1,3-diamine |
| SMILES | C=CCNc1cccc(Nc2ccc(C(C)(C)C)cc2)c1 |
| InChI | InChI=1S/C19H24N2/c1-5-13-20-17-7-6-8-18(14-17)21-16-11-9-15(10-12-16)19(2,3)4/h5-12,14,20-21H,1,13H2,2-4H3 |
| InChIKey | LATSSYZLIUPAIU-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.42 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|