C27H35N3 — CID 159867167
N,N'-diphenylbut-2-ene-1,4-diamine;ethane;N-prop-2-enylaniline (PubChem CID 159867167) has the molecular formula C27H35N3 and a molecular weight of 401.60 g/mol. Its IUPAC name is N,N'-diphenylbut-2-ene-1,4-diamine;ethane;N-prop-2-enylaniline.
| Compound Name | N,N'-diphenylbut-2-ene-1,4-diamine;ethane;N-prop-2-enylaniline |
|---|---|
| PubChem CID | 159867167 |
| Molecular Formula | C27H35N3 |
| Molecular Weight | 401.60 g/mol |
| Exact Mass | 401.28 |
| IUPAC Name | N,N'-diphenylbut-2-ene-1,4-diamine;ethane;N-prop-2-enylaniline |
| SMILES | C(=CCNc1ccccc1)CNc1ccccc1.C=CCNc1ccccc1.CC |
| InChI | InChI=1S/C16H18N2.C9H11N.C2H6/c1-3-9-15(10-4-1)17-13-7-8-14-18-16-11-5-2-6-12-16;1-2-8-10-9-6-4-3-5-7-9;1-2/h1-12,17-18H,13-14H2;2-7,10H,1,8H2;1-2H3 |
| InChIKey | NRWKXDWBWNEONR-UHFFFAOYSA-N |
| XLogP | 7.08 |
| TPSA | 36.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.60 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|