C16H18N2 — CID 101288969
(E)-N,N'-diphenylbut-2-ene-1,4-diamine (PubChem CID 101288969) has the molecular formula C16H18N2 and a molecular weight of 238.33 g/mol. Its IUPAC name is (E)-N,N'-diphenylbut-2-ene-1,4-diamine.
| Compound Name | (E)-N,N'-diphenylbut-2-ene-1,4-diamine |
|---|---|
| PubChem CID | 101288969 |
| Molecular Formula | C16H18N2 |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.15 |
| IUPAC Name | (E)-N,N'-diphenylbut-2-ene-1,4-diamine |
| SMILES | C(=C/CNc1ccccc1)\CNc1ccccc1 |
| InChI | InChI=1S/C16H18N2/c1-3-9-15(10-4-1)17-13-7-8-14-18-16-11-5-2-6-12-16/h1-12,17-18H,13-14H2/b8-7+ |
| InChIKey | VBFKCONKVJDDEC-BQYQJAHWSA-N |
| XLogP | 3.77 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|