C17H17ClN2O — CID 176529986
5-anilino-1-phenyliminopenta-1,3-dien-2-ol;hydrochloride (PubChem CID 176529986) has the molecular formula C17H17ClN2O and a molecular weight of 300.79 g/mol. Its IUPAC name is 5-anilino-1-phenyliminopenta-1,3-dien-2-ol;hydrochloride.
| Compound Name | 5-anilino-1-phenyliminopenta-1,3-dien-2-ol;hydrochloride |
|---|---|
| PubChem CID | 176529986 |
| Molecular Formula | C17H17ClN2O |
| Molecular Weight | 300.79 g/mol |
| Exact Mass | 300.10 |
| IUPAC Name | 5-anilino-1-phenyliminopenta-1,3-dien-2-ol;hydrochloride |
| SMILES | Cl.OC(=C=Nc1ccccc1)C=CCNc1ccccc1 |
| InChI | InChI=1S/C17H16N2O.ClH/c20-17(14-19-16-10-5-2-6-11-16)12-7-13-18-15-8-3-1-4-9-15;/h1-12,18,20H,13H2;1H |
| InChIKey | LXXDEPUJCBMUIR-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 44.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.79 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|