2-anilinoacetic acid;formic acid

C9H11NO4 — CID 174518720

IUPAC2-anilinoacetic acid;formic acid
SMILESO=C(O)CNc1ccccc1.O=CO
InChIInChI=1S/C8H9NO2.CH2O2/c10-8(11)6-9-7-4-2-1-3-5-7;2-1-3/h1-5,9H,6H2,(H,10,11);1H,(H,2,3)
InChIKeyXGTGWAQTGMWALD-UHFFFAOYSA-N
MW197.19 g/mol
LogP0.88
Rot. Bonds3

About 2-anilinoacetic acid;formic acid

2-anilinoacetic acid;formic acid (PubChem CID 174518720) has the molecular formula C9H11NO4 and a molecular weight of 197.19 g/mol. Its IUPAC name is 2-anilinoacetic acid;formic acid.

Molecular Properties

Compound Name2-anilinoacetic acid;formic acid
PubChem CID174518720
Molecular FormulaC9H11NO4
Molecular Weight197.19 g/mol
Exact Mass197.07
IUPAC Name2-anilinoacetic acid;formic acid
SMILESO=C(O)CNc1ccccc1.O=CO
InChIInChI=1S/C8H9NO2.CH2O2/c10-8(11)6-9-7-4-2-1-3-5-7;2-1-3/h1-5,9H,6H2,(H,10,11);1H,(H,2,3)
InChIKeyXGTGWAQTGMWALD-UHFFFAOYSA-N
XLogP0.88
TPSA86.63 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500197.19
LogP ≤ 50.88
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'aldehyde', 'substructure': 'N/A'}

Analyze 2-anilinoacetic acid;formic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-anilinoacetic acid;formic acid?
The IUPAC name of 2-anilinoacetic acid;formic acid (CID 174518720) is 2-anilinoacetic acid;formic acid.
What is the SMILES notation for 2-anilinoacetic acid;formic acid?
The canonical SMILES for 2-anilinoacetic acid;formic acid is O=C(O)CNc1ccccc1.O=CO.
What is the InChIKey of 2-anilinoacetic acid;formic acid?
The InChIKey is XGTGWAQTGMWALD-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9NO2.CH2O2/c10-8(11)6-9-7-4-2-1-3-5-7;2-1-3/h1-5,9H,6H2,(H,10,11);1H,(H,2,3).
What are the key properties of 2-anilinoacetic acid;formic acid?
2-anilinoacetic acid;formic acid has a molecular weight of 197.19 g/mol, XLogP of 0.88, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-anilinoacetic acid;formic acid is sourced from PubChem (CID 174518720), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).