About 2-anilinoacetic acid;pentylhydrazine
2-anilinoacetic acid;pentylhydrazine (PubChem CID 174942831) has the molecular formula C13H23N3O2
and a molecular weight of 253.35 g/mol. Its IUPAC name is 2-anilinoacetic acid;pentylhydrazine.
Molecular Properties
| Compound Name | 2-anilinoacetic acid;pentylhydrazine |
| PubChem CID | 174942831 |
| Molecular Formula | C13H23N3O2 |
| Molecular Weight | 253.35 g/mol |
| Exact Mass | 253.18 |
| IUPAC Name | 2-anilinoacetic acid;pentylhydrazine |
| SMILES | CCCCCNN.O=C(O)CNc1ccccc1 |
| InChI | InChI=1S/C8H9NO2.C5H14N2/c10-8(11)6-9-7-4-2-1-3-5-7;1-2-3-4-5-7-6/h1-5,9H,6H2,(H,10,11);7H,2-6H2,1H3 |
| InChIKey | AHQHMYOOELJSPN-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 87.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.35 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-anilinoacetic acid;pentylhydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-anilinoacetic acid;pentylhydrazine?
The IUPAC name of 2-anilinoacetic acid;pentylhydrazine (CID 174942831) is 2-anilinoacetic acid;pentylhydrazine.
What is the SMILES notation for 2-anilinoacetic acid;pentylhydrazine?
The canonical SMILES for 2-anilinoacetic acid;pentylhydrazine is CCCCCNN.O=C(O)CNc1ccccc1.
What is the InChIKey of 2-anilinoacetic acid;pentylhydrazine?
The InChIKey is AHQHMYOOELJSPN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9NO2.C5H14N2/c10-8(11)6-9-7-4-2-1-3-5-7;1-2-3-4-5-7-6/h1-5,9H,6H2,(H,10,11);7H,2-6H2,1H3.
What are the key properties of 2-anilinoacetic acid;pentylhydrazine?
2-anilinoacetic acid;pentylhydrazine has a molecular weight of 253.35 g/mol, XLogP of 1.82, 7 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-anilinoacetic acid;pentylhydrazine is sourced from PubChem (CID 174942831), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).