C26H54N8O8 — CID 173409428
benzene-1,2,4,5-tetracarboxylic acid;butylhydrazine (PubChem CID 173409428) has the molecular formula C26H54N8O8 and a molecular weight of 606.77 g/mol. Its IUPAC name is benzene-1,2,4,5-tetracarboxylic acid;butylhydrazine.
| Compound Name | benzene-1,2,4,5-tetracarboxylic acid;butylhydrazine |
|---|---|
| PubChem CID | 173409428 |
| Molecular Formula | C26H54N8O8 |
| Molecular Weight | 606.77 g/mol |
| Exact Mass | 606.41 |
| IUPAC Name | benzene-1,2,4,5-tetracarboxylic acid;butylhydrazine |
| SMILES | CCCCNN.CCCCNN.CCCCNN.CCCCNN.O=C(O)c1cc(C(=O)O)c(C(=O)O)cc1C(=O)O |
| InChI | InChI=1S/C10H6O8.4C4H12N2/c11-7(12)3-1-4(8(13)14)6(10(17)18)2-5(3)9(15)16;4*1-2-3-4-6-5/h1-2H,(H,11,12)(H,13,14)(H,15,16)(H,17,18);4*6H,2-5H2,1H3 |
| InChIKey | NHRWWNXHXWKARO-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 301.40 Ų |
| H-Bond Donors | 12 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.77 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 12 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|