About bis(2-anilinoacetate);cadmium(2+)
bis(2-anilinoacetate);cadmium(2+) (PubChem CID 88771971) has the molecular formula C16H16CdN2O4
and a molecular weight of 412.73 g/mol. Its IUPAC name is bis(2-anilinoacetate);cadmium(2+).
Molecular Properties
| Compound Name | bis(2-anilinoacetate);cadmium(2+) |
| PubChem CID | 88771971 |
| Molecular Formula | C16H16CdN2O4 |
| Molecular Weight | 412.73 g/mol |
| Exact Mass | 414.01 |
| IUPAC Name | bis(2-anilinoacetate);cadmium(2+) |
| SMILES | O=C([O-])CNc1ccccc1.O=C([O-])CNc1ccccc1.[Cd+2] |
| InChI | InChI=1S/2C8H9NO2.Cd/c2*10-8(11)6-9-7-4-2-1-3-5-7;/h2*1-5,9H,6H2,(H,10,11);/q;;+2/p-2 |
| InChIKey | HBPSHYDNXAUNEO-UHFFFAOYSA-L |
| XLogP | -0.31 |
| TPSA | 104.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 412.73 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze bis(2-anilinoacetate);cadmium(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(2-anilinoacetate);cadmium(2+)?
The IUPAC name of bis(2-anilinoacetate);cadmium(2+) (CID 88771971) is bis(2-anilinoacetate);cadmium(2+).
What is the SMILES notation for bis(2-anilinoacetate);cadmium(2+)?
The canonical SMILES for bis(2-anilinoacetate);cadmium(2+) is O=C([O-])CNc1ccccc1.O=C([O-])CNc1ccccc1.[Cd+2].
What is the InChIKey of bis(2-anilinoacetate);cadmium(2+)?
The InChIKey is HBPSHYDNXAUNEO-UHFFFAOYSA-L. The full InChI is InChI=1S/2C8H9NO2.Cd/c2*10-8(11)6-9-7-4-2-1-3-5-7;/h2*1-5,9H,6H2,(H,10,11);/q;;+2/p-2.
What are the key properties of bis(2-anilinoacetate);cadmium(2+)?
bis(2-anilinoacetate);cadmium(2+) has a molecular weight of 412.73 g/mol, XLogP of -0.31, 6 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for bis(2-anilinoacetate);cadmium(2+) is sourced from PubChem (CID 88771971), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).