About 2-anilinoacetic acid;2-[bis(2-hydroxyethyl)amino]ethanol
2-anilinoacetic acid;2-[bis(2-hydroxyethyl)amino]ethanol (PubChem CID 130383963) has the molecular formula C14H24N2O5
and a molecular weight of 300.35 g/mol. Its IUPAC name is 2-anilinoacetic acid;2-[bis(2-hydroxyethyl)amino]ethanol.
Molecular Properties
| Compound Name | 2-anilinoacetic acid;2-[bis(2-hydroxyethyl)amino]ethanol |
| PubChem CID | 130383963 |
| Molecular Formula | C14H24N2O5 |
| Molecular Weight | 300.35 g/mol |
| Exact Mass | 300.17 |
| IUPAC Name | 2-anilinoacetic acid;2-[bis(2-hydroxyethyl)amino]ethanol |
| SMILES | O=C(O)CNc1ccccc1.OCCN(CCO)CCO |
| InChI | InChI=1S/C8H9NO2.C6H15NO3/c10-8(11)6-9-7-4-2-1-3-5-7;8-4-1-7(2-5-9)3-6-10/h1-5,9H,6H2,(H,10,11);8-10H,1-6H2 |
| InChIKey | SVWVJEALZNGGHN-UHFFFAOYSA-N |
| XLogP | -0.55 |
| TPSA | 113.26 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.35 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-anilinoacetic acid;2-[bis(2-hydroxyethyl)amino]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-anilinoacetic acid;2-[bis(2-hydroxyethyl)amino]ethanol?
The IUPAC name of 2-anilinoacetic acid;2-[bis(2-hydroxyethyl)amino]ethanol (CID 130383963) is 2-anilinoacetic acid;2-[bis(2-hydroxyethyl)amino]ethanol.
What is the SMILES notation for 2-anilinoacetic acid;2-[bis(2-hydroxyethyl)amino]ethanol?
The canonical SMILES for 2-anilinoacetic acid;2-[bis(2-hydroxyethyl)amino]ethanol is O=C(O)CNc1ccccc1.OCCN(CCO)CCO.
What is the InChIKey of 2-anilinoacetic acid;2-[bis(2-hydroxyethyl)amino]ethanol?
The InChIKey is SVWVJEALZNGGHN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9NO2.C6H15NO3/c10-8(11)6-9-7-4-2-1-3-5-7;8-4-1-7(2-5-9)3-6-10/h1-5,9H,6H2,(H,10,11);8-10H,1-6H2.
What are the key properties of 2-anilinoacetic acid;2-[bis(2-hydroxyethyl)amino]ethanol?
2-anilinoacetic acid;2-[bis(2-hydroxyethyl)amino]ethanol has a molecular weight of 300.35 g/mol, XLogP of -0.55, 9 rotatable bonds, 5 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-anilinoacetic acid;2-[bis(2-hydroxyethyl)amino]ethanol is sourced from PubChem (CID 130383963), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).