C22H36N4O15S — CID 70283063
2-anilinoethanol;2-[bis[2-[bis(carboxymethyl)amino]ethyl]amino]acetic acid;sulfuric acid (PubChem CID 70283063) has the molecular formula C22H36N4O15S and a molecular weight of 628.61 g/mol. Its IUPAC name is 2-anilinoethanol;2-[bis[2-[bis(carboxymethyl)amino]ethyl]amino]acetic acid;sulfuric acid.
| Compound Name | 2-anilinoethanol;2-[bis[2-[bis(carboxymethyl)amino]ethyl]amino]acetic acid;sulfuric acid |
|---|---|
| PubChem CID | 70283063 |
| Molecular Formula | C22H36N4O15S |
| Molecular Weight | 628.61 g/mol |
| Exact Mass | 628.19 |
| IUPAC Name | 2-anilinoethanol;2-[bis[2-[bis(carboxymethyl)amino]ethyl]amino]acetic acid;sulfuric acid |
| SMILES | O=C(O)CN(CCN(CC(=O)O)CC(=O)O)CCN(CC(=O)O)CC(=O)O.O=S(=O)(O)O.OCCNc1ccccc1 |
| InChI | InChI=1S/C14H23N3O10.C8H11NO.H2O4S/c18-10(19)5-15(1-3-16(6-11(20)21)7-12(22)23)2-4-17(8-13(24)25)9-14(26)27;10-7-6-9-8-4-2-1-3-5-8;1-5(2,3)4/h1-9H2,(H,18,19)(H,20,21)(H,22,23)(H,24,25)(H,26,27);1-5,9-10H,6-7H2;(H2,1,2,3,4) |
| InChIKey | KZQYBVUOAGFTRI-UHFFFAOYSA-N |
| XLogP | -2.25 |
| TPSA | 303.08 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.61 |
| LogP ≤ 5 | -2.25 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|