C17H19ClN2 — CID 156769012
N,N'-diphenylpenta-1,3-diene-1,5-diamine;hydrochloride (PubChem CID 156769012) has the molecular formula C17H19ClN2 and a molecular weight of 286.81 g/mol. Its IUPAC name is N,N'-diphenylpenta-1,3-diene-1,5-diamine;hydrochloride.
| Compound Name | N,N'-diphenylpenta-1,3-diene-1,5-diamine;hydrochloride |
|---|---|
| PubChem CID | 156769012 |
| Molecular Formula | C17H19ClN2 |
| Molecular Weight | 286.81 g/mol |
| Exact Mass | 286.12 |
| IUPAC Name | N,N'-diphenylpenta-1,3-diene-1,5-diamine;hydrochloride |
| SMILES | C(C=CNc1ccccc1)=CCNc1ccccc1.Cl |
| InChI | InChI=1S/C17H18N2.ClH/c1-4-10-16(11-5-1)18-14-8-3-9-15-19-17-12-6-2-7-13-17;/h1-14,18-19H,15H2;1H |
| InChIKey | KBHPJZNRPYBVNO-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.81 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|