C22H22N2 — CID 151597012
N-(6-phenyliminodeca-1,3,7,9-tetraenyl)aniline (PubChem CID 151597012) has the molecular formula C22H22N2 and a molecular weight of 314.43 g/mol. Its IUPAC name is N-(6-phenyliminodeca-1,3,7,9-tetraenyl)aniline.
| Compound Name | N-(6-phenyliminodeca-1,3,7,9-tetraenyl)aniline |
|---|---|
| PubChem CID | 151597012 |
| Molecular Formula | C22H22N2 |
| Molecular Weight | 314.43 g/mol |
| Exact Mass | 314.18 |
| IUPAC Name | N-(6-phenyliminodeca-1,3,7,9-tetraenyl)aniline |
| SMILES | C=CC=C/C(CC=CC=CNc1ccccc1)=N\c1ccccc1 |
| InChI | InChI=1S/C22H22N2/c1-2-3-13-21(24-22-16-9-5-10-17-22)18-11-6-12-19-23-20-14-7-4-8-15-20/h2-17,19,23H,1,18H2/b11-6?,13-3?,19-12?,24-21+ |
| InChIKey | QJRHXHCRRRTKBJ-PQFJBPTISA-N |
| XLogP | 6.07 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.43 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|