C21H24N4 — CID 142296381
(3Z,6Z)-2,4-diamino-N,N'-diphenylnona-3,6,8-trienimidamide (PubChem CID 142296381) has the molecular formula C21H24N4 and a molecular weight of 332.45 g/mol. Its IUPAC name is (3Z,6Z)-2,4-diamino-N,N'-diphenylnona-3,6,8-trienimidamide.
| Compound Name | (3Z,6Z)-2,4-diamino-N,N'-diphenylnona-3,6,8-trienimidamide |
|---|---|
| PubChem CID | 142296381 |
| Molecular Formula | C21H24N4 |
| Molecular Weight | 332.45 g/mol |
| Exact Mass | 332.20 |
| IUPAC Name | (3Z,6Z)-2,4-diamino-N,N'-diphenylnona-3,6,8-trienimidamide |
| SMILES | C=C/C=C\C/C(N)=C/C(N)/C(=N\c1ccccc1)Nc1ccccc1 |
| InChI | InChI=1S/C21H24N4/c1-2-3-6-11-17(22)16-20(23)21(24-18-12-7-4-8-13-18)25-19-14-9-5-10-15-19/h2-10,12-16,20H,1,11,22-23H2,(H,24,25)/b6-3-,17-16- |
| InChIKey | QJGSTPHTZWAVLK-PVMFJLQQSA-N |
| XLogP | 4.13 |
| TPSA | 76.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.45 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|