C17H20S — CID 173468385
[(3E,6Z)-4-ethenylnona-3,6,8-trien-2-yl]sulfanylbenzene (PubChem CID 173468385) has the molecular formula C17H20S and a molecular weight of 256.41 g/mol. Its IUPAC name is [(3E,6Z)-4-ethenylnona-3,6,8-trien-2-yl]sulfanylbenzene.
| Compound Name | [(3E,6Z)-4-ethenylnona-3,6,8-trien-2-yl]sulfanylbenzene |
|---|---|
| PubChem CID | 173468385 |
| Molecular Formula | C17H20S |
| Molecular Weight | 256.41 g/mol |
| Exact Mass | 256.13 |
| IUPAC Name | [(3E,6Z)-4-ethenylnona-3,6,8-trien-2-yl]sulfanylbenzene |
| SMILES | C=C/C=C\C/C(C=C)=C\C(C)Sc1ccccc1 |
| InChI | InChI=1S/C17H20S/c1-4-6-8-11-16(5-2)14-15(3)18-17-12-9-7-10-13-17/h4-10,12-15H,1-2,11H2,3H3/b8-6-,16-14- |
| InChIKey | KCLXAJHCGWOODB-CIINBXFRSA-N |
| XLogP | 5.41 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.41 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|