C14H18OS — CID 11402076
(3S,5E)-1-phenylsulfanylocta-5,7-dien-3-ol (PubChem CID 11402076) has the molecular formula C14H18OS and a molecular weight of 234.36 g/mol. Its IUPAC name is (3S,5E)-1-phenylsulfanylocta-5,7-dien-3-ol.
| Compound Name | (3S,5E)-1-phenylsulfanylocta-5,7-dien-3-ol |
|---|---|
| PubChem CID | 11402076 |
| Molecular Formula | C14H18OS |
| Molecular Weight | 234.36 g/mol |
| Exact Mass | 234.11 |
| IUPAC Name | (3S,5E)-1-phenylsulfanylocta-5,7-dien-3-ol |
| SMILES | C=C/C=C/C[C@H](O)CCSc1ccccc1 |
| InChI | InChI=1S/C14H18OS/c1-2-3-5-8-13(15)11-12-16-14-9-6-4-7-10-14/h2-7,9-10,13,15H,1,8,11-12H2/b5-3+/t13-/m0/s1 |
| InChIKey | YXLMVKOXPVVEHE-LQPUYASZSA-N |
| XLogP | 3.66 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.36 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|