C12H16O2S — CID 10977115
(E,5S)-6-phenylsulfanylhex-2-ene-1,5-diol (PubChem CID 10977115) has the molecular formula C12H16O2S and a molecular weight of 224.33 g/mol. Its IUPAC name is (E,5S)-6-phenylsulfanylhex-2-ene-1,5-diol.
| Compound Name | (E,5S)-6-phenylsulfanylhex-2-ene-1,5-diol |
|---|---|
| PubChem CID | 10977115 |
| Molecular Formula | C12H16O2S |
| Molecular Weight | 224.33 g/mol |
| Exact Mass | 224.09 |
| IUPAC Name | (E,5S)-6-phenylsulfanylhex-2-ene-1,5-diol |
| SMILES | OC/C=C/C[C@H](O)CSc1ccccc1 |
| InChI | InChI=1S/C12H16O2S/c13-9-5-4-6-11(14)10-15-12-7-2-1-3-8-12/h1-5,7-8,11,13-14H,6,9-10H2/b5-4+/t11-/m0/s1 |
| InChIKey | KSNDDHCAWZRMMF-ZWNMCFTASA-N |
| XLogP | 2.08 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.33 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|