C8H14O — CID 12576352
(5E)-octa-5,7-dien-3-ol (PubChem CID 12576352) has the molecular formula C8H14O and a molecular weight of 126.20 g/mol. Its IUPAC name is (5E)-octa-5,7-dien-3-ol.
| Compound Name | (5E)-octa-5,7-dien-3-ol |
|---|---|
| PubChem CID | 12576352 |
| Molecular Formula | C8H14O |
| Molecular Weight | 126.20 g/mol |
| Exact Mass | 126.10 |
| IUPAC Name | (5E)-octa-5,7-dien-3-ol |
| SMILES | C=C/C=C/CC(O)CC |
| InChI | InChI=1S/C8H14O/c1-3-5-6-7-8(9)4-2/h3,5-6,8-9H,1,4,7H2,2H3/b6-5+ |
| InChIKey | MNZVNPXBJGMTLY-AATRIKPKSA-N |
| XLogP | 1.89 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 126.20 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|