C10H18O — CID 162418483
(4S,6E)-2-methylnona-6,8-dien-4-ol (PubChem CID 162418483) has the molecular formula C10H18O and a molecular weight of 154.25 g/mol. Its IUPAC name is (4S,6E)-2-methylnona-6,8-dien-4-ol.
| Compound Name | (4S,6E)-2-methylnona-6,8-dien-4-ol |
|---|---|
| PubChem CID | 162418483 |
| Molecular Formula | C10H18O |
| Molecular Weight | 154.25 g/mol |
| Exact Mass | 154.14 |
| IUPAC Name | (4S,6E)-2-methylnona-6,8-dien-4-ol |
| SMILES | C=C/C=C/C[C@@H](O)CC(C)C |
| InChI | InChI=1S/C10H18O/c1-4-5-6-7-10(11)8-9(2)3/h4-6,9-11H,1,7-8H2,2-3H3/b6-5+/t10-/m1/s1 |
| InChIKey | JMLQFKGXAISYFL-BRAIEQGRSA-N |
| XLogP | 2.53 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.25 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|