C10H14O2 — CID 539300
3-penta-2,4-dienylpentane-2,4-dione (PubChem CID 539300) has the molecular formula C10H14O2 and a molecular weight of 166.22 g/mol. Its IUPAC name is 3-penta-2,4-dienylpentane-2,4-dione.
| Compound Name | 3-penta-2,4-dienylpentane-2,4-dione |
|---|---|
| PubChem CID | 539300 |
| Molecular Formula | C10H14O2 |
| Molecular Weight | 166.22 g/mol |
| Exact Mass | 166.10 |
| IUPAC Name | 3-penta-2,4-dienylpentane-2,4-dione |
| SMILES | C=CC=CCC(C(C)=O)C(C)=O |
| InChI | InChI=1S/C10H14O2/c1-4-5-6-7-10(8(2)11)9(3)12/h4-6,10H,1,7H2,2-3H3 |
| InChIKey | FEJWXJKKSRPXLY-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.22 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|