About 2-acetylpent-4-enoate;methanolate;titanium(4+)
2-acetylpent-4-enoate;methanolate;titanium(4+) (PubChem CID 173160592) has the molecular formula C10H18O6Ti
and a molecular weight of 282.12 g/mol. Its IUPAC name is 2-acetylpent-4-enoate;methanolate;titanium(4+).
Molecular Properties
| Compound Name | 2-acetylpent-4-enoate;methanolate;titanium(4+) |
| PubChem CID | 173160592 |
| Molecular Formula | C10H18O6Ti |
| Molecular Weight | 282.12 g/mol |
| Exact Mass | 282.06 |
| IUPAC Name | 2-acetylpent-4-enoate;methanolate;titanium(4+) |
| SMILES | C=CCC(C(C)=O)C(=O)[O-].C[O-].C[O-].C[O-].[Ti+4] |
| InChI | InChI=1S/C7H10O3.3CH3O.Ti/c1-3-4-6(5(2)8)7(9)10;3*1-2;/h3,6H,1,4H2,2H3,(H,9,10);3*1H3;/q;3*-1;+4/p-1 |
| InChIKey | CCBLGINAEADACF-UHFFFAOYSA-M |
| XLogP | -3.56 |
| TPSA | 126.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.12 |
| LogP ≤ 5 | -3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-acetylpent-4-enoate;methanolate;titanium(4+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-acetylpent-4-enoate;methanolate;titanium(4+)?
The IUPAC name of 2-acetylpent-4-enoate;methanolate;titanium(4+) (CID 173160592) is 2-acetylpent-4-enoate;methanolate;titanium(4+).
What is the SMILES notation for 2-acetylpent-4-enoate;methanolate;titanium(4+)?
The canonical SMILES for 2-acetylpent-4-enoate;methanolate;titanium(4+) is C=CCC(C(C)=O)C(=O)[O-].C[O-].C[O-].C[O-].[Ti+4].
What is the InChIKey of 2-acetylpent-4-enoate;methanolate;titanium(4+)?
The InChIKey is CCBLGINAEADACF-UHFFFAOYSA-M. The full InChI is InChI=1S/C7H10O3.3CH3O.Ti/c1-3-4-6(5(2)8)7(9)10;3*1-2;/h3,6H,1,4H2,2H3,(H,9,10);3*1H3;/q;3*-1;+4/p-1.
What are the key properties of 2-acetylpent-4-enoate;methanolate;titanium(4+)?
2-acetylpent-4-enoate;methanolate;titanium(4+) has a molecular weight of 282.12 g/mol, XLogP of -3.56, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-acetylpent-4-enoate;methanolate;titanium(4+) is sourced from PubChem (CID 173160592), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).