About 2-hydroxypent-4-enoate
2-hydroxypent-4-enoate (PubChem CID 23063769) has the molecular formula C5H7O3-
and a molecular weight of 115.11 g/mol. Its IUPAC name is 2-hydroxypent-4-enoate.
Molecular Properties
| Compound Name | 2-hydroxypent-4-enoate |
| PubChem CID | 23063769 |
| Molecular Formula | C5H7O3- |
| Molecular Weight | 115.11 g/mol |
| Exact Mass | 115.04 |
| IUPAC Name | 2-hydroxypent-4-enoate |
| SMILES | C=CCC(O)C(=O)[O-] |
| InChI | InChI=1S/C5H8O3/c1-2-3-4(6)5(7)8/h2,4,6H,1,3H2,(H,7,8)/p-1 |
| InChIKey | VFSVBYJVPHDQQC-UHFFFAOYSA-M |
| XLogP | -1.33 |
| TPSA | 60.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 115.11 |
| LogP ≤ 5 | -1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-hydroxypent-4-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxypent-4-enoate?
The IUPAC name of 2-hydroxypent-4-enoate (CID 23063769) is 2-hydroxypent-4-enoate.
What is the SMILES notation for 2-hydroxypent-4-enoate?
The canonical SMILES for 2-hydroxypent-4-enoate is C=CCC(O)C(=O)[O-].
What is the InChIKey of 2-hydroxypent-4-enoate?
The InChIKey is VFSVBYJVPHDQQC-UHFFFAOYSA-M. The full InChI is InChI=1S/C5H8O3/c1-2-3-4(6)5(7)8/h2,4,6H,1,3H2,(H,7,8)/p-1.
What are the key properties of 2-hydroxypent-4-enoate?
2-hydroxypent-4-enoate has a molecular weight of 115.11 g/mol, XLogP of -1.33, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxypent-4-enoate is sourced from PubChem (CID 23063769), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).