About 2-(2-sulfanylideneethyl)pent-4-enoate;trimethylstannanylium
2-(2-sulfanylideneethyl)pent-4-enoate;trimethylstannanylium (PubChem CID 88796133) has the molecular formula C10H18O2SSn
and a molecular weight of 321.03 g/mol. Its IUPAC name is 2-(2-sulfanylideneethyl)pent-4-enoate;trimethylstannanylium.
Molecular Properties
| Compound Name | 2-(2-sulfanylideneethyl)pent-4-enoate;trimethylstannanylium |
| PubChem CID | 88796133 |
| Molecular Formula | C10H18O2SSn |
| Molecular Weight | 321.03 g/mol |
| Exact Mass | 322.00 |
| IUPAC Name | 2-(2-sulfanylideneethyl)pent-4-enoate;trimethylstannanylium |
| SMILES | C=CCC(CC=S)C(=O)[O-].C[Sn+](C)C |
| InChI | InChI=1S/C7H10O2S.3CH3.Sn/c1-2-3-6(4-5-10)7(8)9;;;;/h2,5-6H,1,3-4H2,(H,8,9);3*1H3;/q;;;;+1/p-1 |
| InChIKey | PBIPYWSPDFLGQR-UHFFFAOYSA-M |
| XLogP | 1.69 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.03 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-sulfanylideneethyl)pent-4-enoate;trimethylstannanylium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-sulfanylideneethyl)pent-4-enoate;trimethylstannanylium?
The IUPAC name of 2-(2-sulfanylideneethyl)pent-4-enoate;trimethylstannanylium (CID 88796133) is 2-(2-sulfanylideneethyl)pent-4-enoate;trimethylstannanylium.
What is the SMILES notation for 2-(2-sulfanylideneethyl)pent-4-enoate;trimethylstannanylium?
The canonical SMILES for 2-(2-sulfanylideneethyl)pent-4-enoate;trimethylstannanylium is C=CCC(CC=S)C(=O)[O-].C[Sn+](C)C.
What is the InChIKey of 2-(2-sulfanylideneethyl)pent-4-enoate;trimethylstannanylium?
The InChIKey is PBIPYWSPDFLGQR-UHFFFAOYSA-M. The full InChI is InChI=1S/C7H10O2S.3CH3.Sn/c1-2-3-6(4-5-10)7(8)9;;;;/h2,5-6H,1,3-4H2,(H,8,9);3*1H3;/q;;;;+1/p-1.
What are the key properties of 2-(2-sulfanylideneethyl)pent-4-enoate;trimethylstannanylium?
2-(2-sulfanylideneethyl)pent-4-enoate;trimethylstannanylium has a molecular weight of 321.03 g/mol, XLogP of 1.69, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-sulfanylideneethyl)pent-4-enoate;trimethylstannanylium is sourced from PubChem (CID 88796133), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).