About (E)-2-ethylhept-4-enoate
(E)-2-ethylhept-4-enoate (PubChem CID 23023844) has the molecular formula C9H15O2-
and a molecular weight of 155.22 g/mol. Its IUPAC name is (E)-2-ethylhept-4-enoate.
Molecular Properties
| Compound Name | (E)-2-ethylhept-4-enoate |
| PubChem CID | 23023844 |
| Molecular Formula | C9H15O2- |
| Molecular Weight | 155.22 g/mol |
| Exact Mass | 155.11 |
| IUPAC Name | (E)-2-ethylhept-4-enoate |
| SMILES | CC/C=C/CC(CC)C(=O)[O-] |
| InChI | InChI=1S/C9H16O2/c1-3-5-6-7-8(4-2)9(10)11/h5-6,8H,3-4,7H2,1-2H3,(H,10,11)/p-1/b6-5+ |
| InChIKey | APIOQYRJKMQRPP-AATRIKPKSA-M |
| XLogP | 1.12 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.22 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (E)-2-ethylhept-4-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-2-ethylhept-4-enoate?
The IUPAC name of (E)-2-ethylhept-4-enoate (CID 23023844) is (E)-2-ethylhept-4-enoate.
What is the SMILES notation for (E)-2-ethylhept-4-enoate?
The canonical SMILES for (E)-2-ethylhept-4-enoate is CC/C=C/CC(CC)C(=O)[O-].
What is the InChIKey of (E)-2-ethylhept-4-enoate?
The InChIKey is APIOQYRJKMQRPP-AATRIKPKSA-M. The full InChI is InChI=1S/C9H16O2/c1-3-5-6-7-8(4-2)9(10)11/h5-6,8H,3-4,7H2,1-2H3,(H,10,11)/p-1/b6-5+.
What are the key properties of (E)-2-ethylhept-4-enoate?
(E)-2-ethylhept-4-enoate has a molecular weight of 155.22 g/mol, XLogP of 1.12, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-2-ethylhept-4-enoate is sourced from PubChem (CID 23023844), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).