About 2-ethylhexanoate;tritert-butylstannanylium
2-ethylhexanoate;tritert-butylstannanylium (PubChem CID 87140511) has the molecular formula C20H42O2Sn
and a molecular weight of 433.27 g/mol. Its IUPAC name is 2-ethylhexanoate;tritert-butylstannanylium.
Molecular Properties
| Compound Name | 2-ethylhexanoate;tritert-butylstannanylium |
| PubChem CID | 87140511 |
| Molecular Formula | C20H42O2Sn |
| Molecular Weight | 433.27 g/mol |
| Exact Mass | 434.22 |
| IUPAC Name | 2-ethylhexanoate;tritert-butylstannanylium |
| SMILES | CC(C)(C)[Sn+](C(C)(C)C)C(C)(C)C.CCCCC(CC)C(=O)[O-] |
| InChI | InChI=1S/C8H16O2.3C4H9.Sn/c1-3-5-6-7(4-2)8(9)10;3*1-4(2)3;/h7H,3-6H2,1-2H3,(H,9,10);3*1-3H3;/q;;;;+1/p-1 |
| InChIKey | FECNWBFZBIEFIR-UHFFFAOYSA-M |
| XLogP | 5.83 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 433.27 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-ethylhexanoate;tritert-butylstannanylium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethylhexanoate;tritert-butylstannanylium?
The IUPAC name of 2-ethylhexanoate;tritert-butylstannanylium (CID 87140511) is 2-ethylhexanoate;tritert-butylstannanylium.
What is the SMILES notation for 2-ethylhexanoate;tritert-butylstannanylium?
The canonical SMILES for 2-ethylhexanoate;tritert-butylstannanylium is CC(C)(C)[Sn+](C(C)(C)C)C(C)(C)C.CCCCC(CC)C(=O)[O-].
What is the InChIKey of 2-ethylhexanoate;tritert-butylstannanylium?
The InChIKey is FECNWBFZBIEFIR-UHFFFAOYSA-M. The full InChI is InChI=1S/C8H16O2.3C4H9.Sn/c1-3-5-6-7(4-2)8(9)10;3*1-4(2)3;/h7H,3-6H2,1-2H3,(H,9,10);3*1-3H3;/q;;;;+1/p-1.
What are the key properties of 2-ethylhexanoate;tritert-butylstannanylium?
2-ethylhexanoate;tritert-butylstannanylium has a molecular weight of 433.27 g/mol, XLogP of 5.83, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethylhexanoate;tritert-butylstannanylium is sourced from PubChem (CID 87140511), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).