About chloro(dimethyl)stannanylium;2-ethylhexanoate
chloro(dimethyl)stannanylium;2-ethylhexanoate (PubChem CID 88712033) has the molecular formula C10H21ClO2Sn
and a molecular weight of 327.44 g/mol. Its IUPAC name is chloro(dimethyl)stannanylium;2-ethylhexanoate.
Molecular Properties
| Compound Name | chloro(dimethyl)stannanylium;2-ethylhexanoate |
| PubChem CID | 88712033 |
| Molecular Formula | C10H21ClO2Sn |
| Molecular Weight | 327.44 g/mol |
| Exact Mass | 328.03 |
| IUPAC Name | chloro(dimethyl)stannanylium;2-ethylhexanoate |
| SMILES | CCCCC(CC)C(=O)[O-].C[Sn+](C)Cl |
| InChI | InChI=1S/C8H16O2.2CH3.ClH.Sn/c1-3-5-6-7(4-2)8(9)10;;;;/h7H,3-6H2,1-2H3,(H,9,10);2*1H3;1H;/q;;;;+2/p-2 |
| InChIKey | YGRKITFOOIGFQG-UHFFFAOYSA-L |
| XLogP | 2.43 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.44 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze chloro(dimethyl)stannanylium;2-ethylhexanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chloro(dimethyl)stannanylium;2-ethylhexanoate?
The IUPAC name of chloro(dimethyl)stannanylium;2-ethylhexanoate (CID 88712033) is chloro(dimethyl)stannanylium;2-ethylhexanoate.
What is the SMILES notation for chloro(dimethyl)stannanylium;2-ethylhexanoate?
The canonical SMILES for chloro(dimethyl)stannanylium;2-ethylhexanoate is CCCCC(CC)C(=O)[O-].C[Sn+](C)Cl.
What is the InChIKey of chloro(dimethyl)stannanylium;2-ethylhexanoate?
The InChIKey is YGRKITFOOIGFQG-UHFFFAOYSA-L. The full InChI is InChI=1S/C8H16O2.2CH3.ClH.Sn/c1-3-5-6-7(4-2)8(9)10;;;;/h7H,3-6H2,1-2H3,(H,9,10);2*1H3;1H;/q;;;;+2/p-2.
What are the key properties of chloro(dimethyl)stannanylium;2-ethylhexanoate?
chloro(dimethyl)stannanylium;2-ethylhexanoate has a molecular weight of 327.44 g/mol, XLogP of 2.43, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for chloro(dimethyl)stannanylium;2-ethylhexanoate is sourced from PubChem (CID 88712033), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).