C12H18K2O4 — CID 138395843
dipotassium;2-oct-2-enylbutanedioate (PubChem CID 138395843) has the molecular formula C12H18K2O4 and a molecular weight of 304.47 g/mol. Its IUPAC name is dipotassium;2-oct-2-enylbutanedioate.
| Compound Name | dipotassium;2-oct-2-enylbutanedioate |
|---|---|
| PubChem CID | 138395843 |
| Molecular Formula | C12H18K2O4 |
| Molecular Weight | 304.47 g/mol |
| Exact Mass | 304.05 |
| IUPAC Name | dipotassium;2-oct-2-enylbutanedioate |
| SMILES | CCCCCC=CCC(CC(=O)[O-])C(=O)[O-].[K+].[K+] |
| InChI | InChI=1S/C12H20O4.2K/c1-2-3-4-5-6-7-8-10(12(15)16)9-11(13)14;;/h6-7,10H,2-5,8-9H2,1H3,(H,13,14)(H,15,16);;/q;2*+1/p-2 |
| InChIKey | XFPYXPMLRXIMCN-UHFFFAOYSA-L |
| XLogP | -5.97 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.47 |
| LogP ≤ 5 | -5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|