C20H35NaO6 — CID 23679912
sodium (E)-2-[2-[2-(2-hydroxyethoxy)ethoxy]-2-oxoethyl]tetradec-4-enoate (PubChem CID 23679912) has the molecular formula C20H35NaO6 and a molecular weight of 394.48 g/mol. Its IUPAC name is sodium (E)-2-[2-[2-(2-hydroxyethoxy)ethoxy]-2-oxoethyl]tetradec-4-enoate.
| Compound Name | sodium (E)-2-[2-[2-(2-hydroxyethoxy)ethoxy]-2-oxoethyl]tetradec-4-enoate |
|---|---|
| PubChem CID | 23679912 |
| Molecular Formula | C20H35NaO6 |
| Molecular Weight | 394.48 g/mol |
| Exact Mass | 394.23 |
| IUPAC Name | sodium (E)-2-[2-[2-(2-hydroxyethoxy)ethoxy]-2-oxoethyl]tetradec-4-enoate |
| SMILES | CCCCCCCCC/C=C/CC(CC(=O)OCCOCCO)C(=O)[O-].[Na+] |
| InChI | InChI=1S/C20H36O6.Na/c1-2-3-4-5-6-7-8-9-10-11-12-18(20(23)24)17-19(22)26-16-15-25-14-13-21;/h10-11,18,21H,2-9,12-17H2,1H3,(H,23,24);/q;+1/p-1/b11-10+; |
| InChIKey | ZMCXYXSAVYLOQY-ASTDGNLGSA-M |
| XLogP | -0.61 |
| TPSA | 95.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.48 |
| LogP ≤ 5 | -0.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|