C18H30K2O4 — CID 6453440
dipotassium;2-[(E)-tetradec-2-enyl]butanedioate (PubChem CID 6453440) has the molecular formula C18H30K2O4 and a molecular weight of 388.63 g/mol. Its IUPAC name is dipotassium;2-[(E)-tetradec-2-enyl]butanedioate.
| Compound Name | dipotassium;2-[(E)-tetradec-2-enyl]butanedioate |
|---|---|
| PubChem CID | 6453440 |
| Molecular Formula | C18H30K2O4 |
| Molecular Weight | 388.63 g/mol |
| Exact Mass | 388.14 |
| IUPAC Name | dipotassium;2-[(E)-tetradec-2-enyl]butanedioate |
| SMILES | CCCCCCCCCCC/C=C/CC(CC(=O)[O-])C(=O)[O-].[K+].[K+] |
| InChI | InChI=1S/C18H32O4.2K/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-16(18(21)22)15-17(19)20;;/h12-13,16H,2-11,14-15H2,1H3,(H,19,20)(H,21,22);;/q;2*+1/p-2/b13-12+;; |
| InChIKey | KOQJWUWGOWQPIU-HPAIREQNSA-L |
| XLogP | -3.63 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.63 |
| LogP ≤ 5 | -3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|