About dipotassium;2-[(E)-octadec-1-enyl]butanedioate
dipotassium;2-[(E)-octadec-1-enyl]butanedioate (PubChem CID 23499725) has the molecular formula C22H38K2O4
and a molecular weight of 444.74 g/mol. Its IUPAC name is dipotassium;2-[(E)-octadec-1-enyl]butanedioate.
Molecular Properties
| Compound Name | dipotassium;2-[(E)-octadec-1-enyl]butanedioate |
| PubChem CID | 23499725 |
| Molecular Formula | C22H38K2O4 |
| Molecular Weight | 444.74 g/mol |
| Exact Mass | 444.20 |
| IUPAC Name | dipotassium;2-[(E)-octadec-1-enyl]butanedioate |
| SMILES | CCCCCCCCCCCCCCCC/C=C/C(CC(=O)[O-])C(=O)[O-].[K+].[K+] |
| InChI | InChI=1S/C22H40O4.2K/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-20(22(25)26)19-21(23)24;;/h17-18,20H,2-16,19H2,1H3,(H,23,24)(H,25,26);;/q;2*+1/p-2/b18-17+;; |
| InChIKey | QQXYKEKPPSATBQ-QIKYXUGXSA-L |
| XLogP | -2.07 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 444.74 |
| LogP ≤ 5 | -2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze dipotassium;2-[(E)-octadec-1-enyl]butanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dipotassium;2-[(E)-octadec-1-enyl]butanedioate?
The IUPAC name of dipotassium;2-[(E)-octadec-1-enyl]butanedioate (CID 23499725) is dipotassium;2-[(E)-octadec-1-enyl]butanedioate.
What is the SMILES notation for dipotassium;2-[(E)-octadec-1-enyl]butanedioate?
The canonical SMILES for dipotassium;2-[(E)-octadec-1-enyl]butanedioate is CCCCCCCCCCCCCCCC/C=C/C(CC(=O)[O-])C(=O)[O-].[K+].[K+].
What is the InChIKey of dipotassium;2-[(E)-octadec-1-enyl]butanedioate?
The InChIKey is QQXYKEKPPSATBQ-QIKYXUGXSA-L. The full InChI is InChI=1S/C22H40O4.2K/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-20(22(25)26)19-21(23)24;;/h17-18,20H,2-16,19H2,1H3,(H,23,24)(H,25,26);;/q;2*+1/p-2/b18-17+;;.
What are the key properties of dipotassium;2-[(E)-octadec-1-enyl]butanedioate?
dipotassium;2-[(E)-octadec-1-enyl]butanedioate has a molecular weight of 444.74 g/mol, XLogP of -2.07, 19 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for dipotassium;2-[(E)-octadec-1-enyl]butanedioate is sourced from PubChem (CID 23499725), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).