cerium;2-dodec-1-enylbutanedioic acid

C16H28CeO4 — CID 174928288

IUPACcerium;2-dodec-1-enylbutanedioic acid
SMILESCCCCCCCCCCC=CC(CC(=O)O)C(=O)O.[Ce]
InChIInChI=1S/C16H28O4.Ce/c1-2-3-4-5-6-7-8-9-10-11-12-14(16(19)20)13-15(17)18;/h11-12,14H,2-10,13H2,1H3,(H,17,18)(H,19,20);
InChIKeyNURSDANFWJDWAW-UHFFFAOYSA-N
MW424.51 g/mol
LogP4.25
Rot. Bonds13

About cerium;2-dodec-1-enylbutanedioic acid

cerium;2-dodec-1-enylbutanedioic acid (PubChem CID 174928288) has the molecular formula C16H28CeO4 and a molecular weight of 424.51 g/mol. Its IUPAC name is cerium;2-dodec-1-enylbutanedioic acid.

Molecular Properties

Compound Namecerium;2-dodec-1-enylbutanedioic acid
PubChem CID174928288
Molecular FormulaC16H28CeO4
Molecular Weight424.51 g/mol
Exact Mass424.10
IUPAC Namecerium;2-dodec-1-enylbutanedioic acid
SMILESCCCCCCCCCCC=CC(CC(=O)O)C(=O)O.[Ce]
InChIInChI=1S/C16H28O4.Ce/c1-2-3-4-5-6-7-8-9-10-11-12-14(16(19)20)13-15(17)18;/h11-12,14H,2-10,13H2,1H3,(H,17,18)(H,19,20);
InChIKeyNURSDANFWJDWAW-UHFFFAOYSA-N
XLogP4.25
TPSA74.60 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds13
Heavy Atoms21
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500424.51
LogP ≤ 54.25
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}

Analyze cerium;2-dodec-1-enylbutanedioic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of cerium;2-dodec-1-enylbutanedioic acid?
The IUPAC name of cerium;2-dodec-1-enylbutanedioic acid (CID 174928288) is cerium;2-dodec-1-enylbutanedioic acid.
What is the SMILES notation for cerium;2-dodec-1-enylbutanedioic acid?
The canonical SMILES for cerium;2-dodec-1-enylbutanedioic acid is CCCCCCCCCCC=CC(CC(=O)O)C(=O)O.[Ce].
What is the InChIKey of cerium;2-dodec-1-enylbutanedioic acid?
The InChIKey is NURSDANFWJDWAW-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H28O4.Ce/c1-2-3-4-5-6-7-8-9-10-11-12-14(16(19)20)13-15(17)18;/h11-12,14H,2-10,13H2,1H3,(H,17,18)(H,19,20);.
What are the key properties of cerium;2-dodec-1-enylbutanedioic acid?
cerium;2-dodec-1-enylbutanedioic acid has a molecular weight of 424.51 g/mol, XLogP of 4.25, 13 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cerium;2-dodec-1-enylbutanedioic acid is sourced from PubChem (CID 174928288), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).