About cerium;2-dodec-1-enylbutanedioic acid
cerium;2-dodec-1-enylbutanedioic acid (PubChem CID 174928288) has the molecular formula C16H28CeO4
and a molecular weight of 424.51 g/mol. Its IUPAC name is cerium;2-dodec-1-enylbutanedioic acid.
Molecular Properties
| Compound Name | cerium;2-dodec-1-enylbutanedioic acid |
| PubChem CID | 174928288 |
| Molecular Formula | C16H28CeO4 |
| Molecular Weight | 424.51 g/mol |
| Exact Mass | 424.10 |
| IUPAC Name | cerium;2-dodec-1-enylbutanedioic acid |
| SMILES | CCCCCCCCCCC=CC(CC(=O)O)C(=O)O.[Ce] |
| InChI | InChI=1S/C16H28O4.Ce/c1-2-3-4-5-6-7-8-9-10-11-12-14(16(19)20)13-15(17)18;/h11-12,14H,2-10,13H2,1H3,(H,17,18)(H,19,20); |
| InChIKey | NURSDANFWJDWAW-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 424.51 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze cerium;2-dodec-1-enylbutanedioic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cerium;2-dodec-1-enylbutanedioic acid?
The IUPAC name of cerium;2-dodec-1-enylbutanedioic acid (CID 174928288) is cerium;2-dodec-1-enylbutanedioic acid.
What is the SMILES notation for cerium;2-dodec-1-enylbutanedioic acid?
The canonical SMILES for cerium;2-dodec-1-enylbutanedioic acid is CCCCCCCCCCC=CC(CC(=O)O)C(=O)O.[Ce].
What is the InChIKey of cerium;2-dodec-1-enylbutanedioic acid?
The InChIKey is NURSDANFWJDWAW-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H28O4.Ce/c1-2-3-4-5-6-7-8-9-10-11-12-14(16(19)20)13-15(17)18;/h11-12,14H,2-10,13H2,1H3,(H,17,18)(H,19,20);.
What are the key properties of cerium;2-dodec-1-enylbutanedioic acid?
cerium;2-dodec-1-enylbutanedioic acid has a molecular weight of 424.51 g/mol, XLogP of 4.25, 13 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cerium;2-dodec-1-enylbutanedioic acid is sourced from PubChem (CID 174928288), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).