azane;2-[(E)-dodec-1-enyl]butanedioic acid

C16H34N2O4 — CID 173459339

IUPACazane;2-[(E)-dodec-1-enyl]butanedioic acid
SMILESCCCCCCCCCC/C=C/C(CC(=O)O)C(=O)O.N.N
InChIInChI=1S/C16H28O4.2H3N/c1-2-3-4-5-6-7-8-9-10-11-12-14(16(19)20)13-15(17)18;;/h11-12,14H,2-10,13H2,1H3,(H,17,18)(H,19,20);2*1H3/b12-11+;;
InChIKeySUQCZJAWTCKORV-YHPRVSEPSA-N
MW318.46 g/mol
LogP4.57
Rot. Bonds13

About azane;2-[(E)-dodec-1-enyl]butanedioic acid

azane;2-[(E)-dodec-1-enyl]butanedioic acid (PubChem CID 173459339) has the molecular formula C16H34N2O4 and a molecular weight of 318.46 g/mol. Its IUPAC name is azane;2-[(E)-dodec-1-enyl]butanedioic acid.

Molecular Properties

Compound Nameazane;2-[(E)-dodec-1-enyl]butanedioic acid
PubChem CID173459339
Molecular FormulaC16H34N2O4
Molecular Weight318.46 g/mol
Exact Mass318.25
IUPAC Nameazane;2-[(E)-dodec-1-enyl]butanedioic acid
SMILESCCCCCCCCCC/C=C/C(CC(=O)O)C(=O)O.N.N
InChIInChI=1S/C16H28O4.2H3N/c1-2-3-4-5-6-7-8-9-10-11-12-14(16(19)20)13-15(17)18;;/h11-12,14H,2-10,13H2,1H3,(H,17,18)(H,19,20);2*1H3/b12-11+;;
InChIKeySUQCZJAWTCKORV-YHPRVSEPSA-N
XLogP4.57
TPSA144.60 Ų
H-Bond Donors4
H-Bond Acceptors4
Rotatable Bonds13
Heavy Atoms22
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500318.46
LogP ≤ 54.57
H-Bond Donors ≤ 54
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}

Analyze azane;2-[(E)-dodec-1-enyl]butanedioic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of azane;2-[(E)-dodec-1-enyl]butanedioic acid?
The IUPAC name of azane;2-[(E)-dodec-1-enyl]butanedioic acid (CID 173459339) is azane;2-[(E)-dodec-1-enyl]butanedioic acid.
What is the SMILES notation for azane;2-[(E)-dodec-1-enyl]butanedioic acid?
The canonical SMILES for azane;2-[(E)-dodec-1-enyl]butanedioic acid is CCCCCCCCCC/C=C/C(CC(=O)O)C(=O)O.N.N.
What is the InChIKey of azane;2-[(E)-dodec-1-enyl]butanedioic acid?
The InChIKey is SUQCZJAWTCKORV-YHPRVSEPSA-N. The full InChI is InChI=1S/C16H28O4.2H3N/c1-2-3-4-5-6-7-8-9-10-11-12-14(16(19)20)13-15(17)18;;/h11-12,14H,2-10,13H2,1H3,(H,17,18)(H,19,20);2*1H3/b12-11+;;.
What are the key properties of azane;2-[(E)-dodec-1-enyl]butanedioic acid?
azane;2-[(E)-dodec-1-enyl]butanedioic acid has a molecular weight of 318.46 g/mol, XLogP of 4.57, 13 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for azane;2-[(E)-dodec-1-enyl]butanedioic acid is sourced from PubChem (CID 173459339), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).