C28H58N2O10 — CID 6455059
bis(2-[bis(2-hydroxyethyl)amino]ethanol);2-[(E)-dodec-1-enyl]butanedioic acid (PubChem CID 6455059) has the molecular formula C28H58N2O10 and a molecular weight of 582.78 g/mol. Its IUPAC name is bis(2-[bis(2-hydroxyethyl)amino]ethanol);2-[(E)-dodec-1-enyl]butanedioic acid.
| Compound Name | bis(2-[bis(2-hydroxyethyl)amino]ethanol);2-[(E)-dodec-1-enyl]butanedioic acid |
|---|---|
| PubChem CID | 6455059 |
| Molecular Formula | C28H58N2O10 |
| Molecular Weight | 582.78 g/mol |
| Exact Mass | 582.41 |
| IUPAC Name | bis(2-[bis(2-hydroxyethyl)amino]ethanol);2-[(E)-dodec-1-enyl]butanedioic acid |
| SMILES | CCCCCCCCCC/C=C/C(CC(=O)O)C(=O)O.OCCN(CCO)CCO.OCCN(CCO)CCO |
| InChI | InChI=1S/C16H28O4.2C6H15NO3/c1-2-3-4-5-6-7-8-9-10-11-12-14(16(19)20)13-15(17)18;2*8-4-1-7(2-5-9)3-6-10/h11-12,14H,2-10,13H2,1H3,(H,17,18)(H,19,20);2*8-10H,1-6H2/b12-11+;; |
| InChIKey | ZATZBEFPTDZRTF-YHPRVSEPSA-N |
| XLogP | 0.78 |
| TPSA | 202.46 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.78 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|