C20H34O4 — CID 101278130
2-[(2E,9E)-hexadeca-2,9-dienyl]butanedioic acid (PubChem CID 101278130) has the molecular formula C20H34O4 and a molecular weight of 338.49 g/mol. Its IUPAC name is 2-[(2E,9E)-hexadeca-2,9-dienyl]butanedioic acid.
| Compound Name | 2-[(2E,9E)-hexadeca-2,9-dienyl]butanedioic acid |
|---|---|
| PubChem CID | 101278130 |
| Molecular Formula | C20H34O4 |
| Molecular Weight | 338.49 g/mol |
| Exact Mass | 338.25 |
| IUPAC Name | 2-[(2E,9E)-hexadeca-2,9-dienyl]butanedioic acid |
| SMILES | CCCCCC/C=C/CCCCC/C=C/CC(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C20H34O4/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-18(20(23)24)17-19(21)22/h7-8,14-15,18H,2-6,9-13,16-17H2,1H3,(H,21,22)(H,23,24)/b8-7+,15-14+ |
| InChIKey | BECMJBIOYFJWOK-BTOGOYLPSA-N |
| XLogP | 5.59 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.49 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|