C18H30O4 — CID 101278112
2-[(2E,12E)-tetradeca-2,12-dienyl]butanedioic acid (PubChem CID 101278112) has the molecular formula C18H30O4 and a molecular weight of 310.43 g/mol. Its IUPAC name is 2-[(2E,12E)-tetradeca-2,12-dienyl]butanedioic acid.
| Compound Name | 2-[(2E,12E)-tetradeca-2,12-dienyl]butanedioic acid |
|---|---|
| PubChem CID | 101278112 |
| Molecular Formula | C18H30O4 |
| Molecular Weight | 310.43 g/mol |
| Exact Mass | 310.21 |
| IUPAC Name | 2-[(2E,12E)-tetradeca-2,12-dienyl]butanedioic acid |
| SMILES | C/C=C/CCCCCCCC/C=C/CC(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C18H30O4/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-16(18(21)22)15-17(19)20/h2-3,12-13,16H,4-11,14-15H2,1H3,(H,19,20)(H,21,22)/b3-2+,13-12+ |
| InChIKey | XDZWKENMBRJQQI-UIEQPHSRSA-N |
| XLogP | 4.81 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.43 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|