C22H40NNaO2 — CID 101275644
sodium 2-[bis[(E)-dec-4-en-2-yl]amino]acetate (PubChem CID 101275644) has the molecular formula C22H40NNaO2 and a molecular weight of 373.56 g/mol. Its IUPAC name is sodium 2-[bis[(E)-dec-4-en-2-yl]amino]acetate.
| Compound Name | sodium 2-[bis[(E)-dec-4-en-2-yl]amino]acetate |
|---|---|
| PubChem CID | 101275644 |
| Molecular Formula | C22H40NNaO2 |
| Molecular Weight | 373.56 g/mol |
| Exact Mass | 373.30 |
| IUPAC Name | sodium 2-[bis[(E)-dec-4-en-2-yl]amino]acetate |
| SMILES | CCCCC/C=C/CC(C)N(CC(=O)[O-])C(C)C/C=C/CCCCC.[Na+] |
| InChI | InChI=1S/C22H41NO2.Na/c1-5-7-9-11-13-15-17-20(3)23(19-22(24)25)21(4)18-16-14-12-10-8-6-2;/h13-16,20-21H,5-12,17-19H2,1-4H3,(H,24,25);/q;+1/p-1/b15-13+,16-14+; |
| InChIKey | HUMMCQXZZOFQIJ-ACJWTMPUSA-M |
| XLogP | 1.87 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.56 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|