C26H48LiNO2 — CID 101275548
lithium 2-[bis[(E)-2-ethyldec-4-enyl]amino]acetate (PubChem CID 101275548) has the molecular formula C26H48LiNO2 and a molecular weight of 413.62 g/mol. Its IUPAC name is lithium 2-[bis[(E)-2-ethyldec-4-enyl]amino]acetate.
| Compound Name | lithium 2-[bis[(E)-2-ethyldec-4-enyl]amino]acetate |
|---|---|
| PubChem CID | 101275548 |
| Molecular Formula | C26H48LiNO2 |
| Molecular Weight | 413.62 g/mol |
| Exact Mass | 413.38 |
| IUPAC Name | lithium 2-[bis[(E)-2-ethyldec-4-enyl]amino]acetate |
| SMILES | CCCCC/C=C/CC(CC)CN(CC(=O)[O-])CC(CC)C/C=C/CCCCC.[Li+] |
| InChI | InChI=1S/C26H49NO2.Li/c1-5-9-11-13-15-17-19-24(7-3)21-27(23-26(28)29)22-25(8-4)20-18-16-14-12-10-6-2;/h15-18,24-25H,5-14,19-23H2,1-4H3,(H,28,29);/q;+1/p-1/b17-15+,18-16+; |
| InChIKey | JDDBOIGOKPFOTB-UZQGXGHZSA-M |
| XLogP | 3.15 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.62 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|