potassium 2-[bis[(E)-2-ethyldec-5-enyl]amino]acetate

C26H48KNO2 — CID 101275621

IUPACpotassium 2-[bis[(E)-2-ethyldec-5-enyl]amino]acetate
SMILESCCCC/C=C/CCC(CC)CN(CC(=O)[O-])CC(CC)CC/C=C/CCCC.[K+]
InChIInChI=1S/C26H49NO2.K/c1-5-9-11-13-15-17-19-24(7-3)21-27(23-26(28)29)22-25(8-4)20-18-16-14-12-10-6-2;/h13-16,24-25H,5-12,17-23H2,1-4H3,(H,28,29);/q;+1/p-1/b15-13+,16-14+;
InChIKeyZBJRBQSKGHSVLK-ACJWTMPUSA-M
MW445.77 g/mol
LogP3.15
Rot. Bonds20

About potassium 2-[bis[(E)-2-ethyldec-5-enyl]amino]acetate

potassium 2-[bis[(E)-2-ethyldec-5-enyl]amino]acetate (PubChem CID 101275621) has the molecular formula C26H48KNO2 and a molecular weight of 445.77 g/mol. Its IUPAC name is potassium 2-[bis[(E)-2-ethyldec-5-enyl]amino]acetate.

Molecular Properties

Compound Namepotassium 2-[bis[(E)-2-ethyldec-5-enyl]amino]acetate
PubChem CID101275621
Molecular FormulaC26H48KNO2
Molecular Weight445.77 g/mol
Exact Mass445.33
IUPAC Namepotassium 2-[bis[(E)-2-ethyldec-5-enyl]amino]acetate
SMILESCCCC/C=C/CCC(CC)CN(CC(=O)[O-])CC(CC)CC/C=C/CCCC.[K+]
InChIInChI=1S/C26H49NO2.K/c1-5-9-11-13-15-17-19-24(7-3)21-27(23-26(28)29)22-25(8-4)20-18-16-14-12-10-6-2;/h13-16,24-25H,5-12,17-23H2,1-4H3,(H,28,29);/q;+1/p-1/b15-13+,16-14+;
InChIKeyZBJRBQSKGHSVLK-ACJWTMPUSA-M
XLogP3.15
TPSA43.37 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds20
Heavy Atoms30
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500445.77
LogP ≤ 53.15
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}

Analyze potassium 2-[bis[(E)-2-ethyldec-5-enyl]amino]acetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of potassium 2-[bis[(E)-2-ethyldec-5-enyl]amino]acetate?
The IUPAC name of potassium 2-[bis[(E)-2-ethyldec-5-enyl]amino]acetate (CID 101275621) is potassium 2-[bis[(E)-2-ethyldec-5-enyl]amino]acetate.
What is the SMILES notation for potassium 2-[bis[(E)-2-ethyldec-5-enyl]amino]acetate?
The canonical SMILES for potassium 2-[bis[(E)-2-ethyldec-5-enyl]amino]acetate is CCCC/C=C/CCC(CC)CN(CC(=O)[O-])CC(CC)CC/C=C/CCCC.[K+].
What is the InChIKey of potassium 2-[bis[(E)-2-ethyldec-5-enyl]amino]acetate?
The InChIKey is ZBJRBQSKGHSVLK-ACJWTMPUSA-M. The full InChI is InChI=1S/C26H49NO2.K/c1-5-9-11-13-15-17-19-24(7-3)21-27(23-26(28)29)22-25(8-4)20-18-16-14-12-10-6-2;/h13-16,24-25H,5-12,17-23H2,1-4H3,(H,28,29);/q;+1/p-1/b15-13+,16-14+;.
What are the key properties of potassium 2-[bis[(E)-2-ethyldec-5-enyl]amino]acetate?
potassium 2-[bis[(E)-2-ethyldec-5-enyl]amino]acetate has a molecular weight of 445.77 g/mol, XLogP of 3.15, 20 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for potassium 2-[bis[(E)-2-ethyldec-5-enyl]amino]acetate is sourced from PubChem (CID 101275621), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).