About (E)-2-butylhept-4-enoic acid
(E)-2-butylhept-4-enoic acid (PubChem CID 166071472) has the molecular formula C11H20O2
and a molecular weight of 184.28 g/mol. Its IUPAC name is (E)-2-butylhept-4-enoic acid.
Molecular Properties
| Compound Name | (E)-2-butylhept-4-enoic acid |
| PubChem CID | 166071472 |
| Molecular Formula | C11H20O2 |
| Molecular Weight | 184.28 g/mol |
| Exact Mass | 184.15 |
| IUPAC Name | (E)-2-butylhept-4-enoic acid |
| SMILES | CC/C=C/CC(CCCC)C(=O)O |
| InChI | InChI=1S/C11H20O2/c1-3-5-7-9-10(11(12)13)8-6-4-2/h5,7,10H,3-4,6,8-9H2,1-2H3,(H,12,13)/b7-5+ |
| InChIKey | MBYYKUFJYMXJCG-FNORWQNLSA-N |
| XLogP | 3.23 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.28 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (E)-2-butylhept-4-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-2-butylhept-4-enoic acid?
The IUPAC name of (E)-2-butylhept-4-enoic acid (CID 166071472) is (E)-2-butylhept-4-enoic acid.
What is the SMILES notation for (E)-2-butylhept-4-enoic acid?
The canonical SMILES for (E)-2-butylhept-4-enoic acid is CC/C=C/CC(CCCC)C(=O)O.
What is the InChIKey of (E)-2-butylhept-4-enoic acid?
The InChIKey is MBYYKUFJYMXJCG-FNORWQNLSA-N. The full InChI is InChI=1S/C11H20O2/c1-3-5-7-9-10(11(12)13)8-6-4-2/h5,7,10H,3-4,6,8-9H2,1-2H3,(H,12,13)/b7-5+.
What are the key properties of (E)-2-butylhept-4-enoic acid?
(E)-2-butylhept-4-enoic acid has a molecular weight of 184.28 g/mol, XLogP of 3.23, 7 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-2-butylhept-4-enoic acid is sourced from PubChem (CID 166071472), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).